C29H30N2O3S — CID 57393129
5-benzyl-3-[(E)-3-(4-hydroxyphenyl)prop-2-enyl]-7-propan-2-yl-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 57393129) has the molecular formula C29H30N2O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is 5-benzyl-3-[(E)-3-(4-hydroxyphenyl)prop-2-enyl]-7-propan-2-yl-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-benzyl-3-[(E)-3-(4-hydroxyphenyl)prop-2-enyl]-7-propan-2-yl-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57393129 |
| Molecular Formula | C29H30N2O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 5-benzyl-3-[(E)-3-(4-hydroxyphenyl)prop-2-enyl]-7-propan-2-yl-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)C1Cc2sc3[nH]c(=O)n(C/C=C/c4ccc(O)cc4)c(=O)c3c2C(Cc2ccccc2)C1 |
| InChI | InChI=1S/C29H30N2O3S/c1-18(2)21-16-22(15-20-7-4-3-5-8-20)25-24(17-21)35-27-26(25)28(33)31(29(34)30-27)14-6-9-19-10-12-23(32)13-11-19/h3-13,18,21-22,32H,14-17H2,1-2H3,(H,30,34)/b9-6+ |
| InChIKey | BGXKMMJXBFMQLU-RMKNXTFCSA-N |
| XLogP | 5.72 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |