C20H13BrN2O3 — CID 57393190
5'-bromo-2-methylspiro[1H-benzo[f]isoindole-3,3'-1H-indole]-2',4,9-trione (PubChem CID 57393190) has the molecular formula C20H13BrN2O3 and a molecular weight of 409.24 g/mol. Its IUPAC name is 5'-bromo-2-methylspiro[1H-benzo[f]isoindole-3,3'-1H-indole]-2',4,9-trione.
| Compound Name | 5'-bromo-2-methylspiro[1H-benzo[f]isoindole-3,3'-1H-indole]-2',4,9-trione |
|---|---|
| PubChem CID | 57393190 |
| Molecular Formula | C20H13BrN2O3 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 5'-bromo-2-methylspiro[1H-benzo[f]isoindole-3,3'-1H-indole]-2',4,9-trione |
| SMILES | CN1CC2=C(C(=O)c3ccccc3C2=O)C12C(=O)Nc1ccc(Br)cc12 |
| InChI | InChI=1S/C20H13BrN2O3/c1-23-9-13-16(18(25)12-5-3-2-4-11(12)17(13)24)20(23)14-8-10(21)6-7-15(14)22-19(20)26/h2-8H,9H2,1H3,(H,22,26) |
| InChIKey | UIVZJSXLYKLVIK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|