C33H36ClF3N4O5 — CID 57393309
(2R)-N-[[5-chloro-2-(3-methoxypropyl)-1-oxidopyridin-1-ium-4-yl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide (PubChem CID 57393309) has the molecular formula C33H36ClF3N4O5 and a molecular weight of 661.12 g/mol. Its IUPAC name is (2R)-N-[[5-chloro-2-(3-methoxypropyl)-1-oxidopyridin-1-ium-4-yl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide.
| Compound Name | (2R)-N-[[5-chloro-2-(3-methoxypropyl)-1-oxidopyridin-1-ium-4-yl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 57393309 |
| Molecular Formula | C33H36ClF3N4O5 |
| Molecular Weight | 661.12 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | (2R)-N-[[5-chloro-2-(3-methoxypropyl)-1-oxidopyridin-1-ium-4-yl]methyl]-N-cyclopropyl-6-oxo-1-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]piperazine-2-carboxamide |
| SMILES | COCCCc1cc(CN(C(=O)[C@H]2CNCC(=O)N2c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)C2CC2)c(Cl)c[n+]1[O-] |
| InChI | InChI=1S/C33H36ClF3N4O5/c1-45-14-3-5-25-16-22(26(34)20-40(25)44)19-39(23-10-11-23)33(43)29-17-38-18-30(42)41(29)24-8-6-21(7-9-24)4-2-15-46-32-28(36)13-12-27(35)31(32)37/h6-9,12-13,16,20,23,29,38H,2-5,10-11,14-15,17-19H2,1H3/t29-/m1/s1 |
| InChIKey | JDVYCEDUXCROFT-GDLZYMKVSA-N |
| XLogP | 4.48 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.12 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|