C23H25F3N2O5S2 — CID 57393340
2-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 57393340) has the molecular formula C23H25F3N2O5S2 and a molecular weight of 530.59 g/mol. Its IUPAC name is 2-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 57393340 |
| Molecular Formula | C23H25F3N2O5S2 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 2-[2-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(2,2,2-trifluoroethoxymethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(SCCN2C(=O)CC[C@@H]2/C=C/[C@@H](O)Cc2cccc(COCC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C23H25F3N2O5S2/c24-23(25,26)14-33-12-16-3-1-2-15(10-16)11-18(29)6-4-17-5-7-20(30)28(17)8-9-34-22-27-19(13-35-22)21(31)32/h1-4,6,10,13,17-18,29H,5,7-9,11-12,14H2,(H,31,32)/b6-4+/t17-,18+/m0/s1 |
| InChIKey | JMAXYFWZAXLUMC-UKZKYTFVSA-N |
| XLogP | 4.16 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|