C15H24N2O2S — CID 57393432
4-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide (PubChem CID 57393432) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 4-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 57393432 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(C)C2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C15H24N2O2S/c1-4-13-5-7-15(8-6-13)20(18,19)17(3)14-9-11-16(2)12-10-14/h5-8,14H,4,9-12H2,1-3H3 |
| InChIKey | DAJNTHNLKGMDAK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |