C17H25N3O — CID 57393438
(9R,13R)-4-[1-(cyclopropylmethoxy)ethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene (PubChem CID 57393438) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (9R,13R)-4-[1-(cyclopropylmethoxy)ethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene.
| Compound Name | (9R,13R)-4-[1-(cyclopropylmethoxy)ethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 57393438 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (9R,13R)-4-[1-(cyclopropylmethoxy)ethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene |
| SMILES | CC(OCC1CC1)c1ccc2c(n1)N1[C@@H](CNC[C@H]1C)C2 |
| InChI | InChI=1S/C17H25N3O/c1-11-8-18-9-15-7-14-5-6-16(19-17(14)20(11)15)12(2)21-10-13-3-4-13/h5-6,11-13,15,18H,3-4,7-10H2,1-2H3/t11-,12?,15-/m1/s1 |
| InChIKey | HBPFKRQLQBROKQ-KKXIITGPSA-N |
| XLogP | 2.29 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |