C16H11ClFN7O3S — CID 57393594
N-[[1-[(2-chloro-6-fluorophenyl)methyl]triazol-4-yl]methyl]-5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 57393594) has the molecular formula C16H11ClFN7O3S and a molecular weight of 435.83 g/mol. Its IUPAC name is N-[[1-[(2-chloro-6-fluorophenyl)methyl]triazol-4-yl]methyl]-5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[[1-[(2-chloro-6-fluorophenyl)methyl]triazol-4-yl]methyl]-5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 57393594 |
| Molecular Formula | C16H11ClFN7O3S |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | N-[[1-[(2-chloro-6-fluorophenyl)methyl]triazol-4-yl]methyl]-5-(5-nitrofuran-2-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(NCc3cn(Cc4c(F)cccc4Cl)nn3)s2)o1 |
| InChI | InChI=1S/C16H11ClFN7O3S/c17-11-2-1-3-12(18)10(11)8-24-7-9(20-23-24)6-19-16-22-21-15(29-16)13-4-5-14(28-13)25(26)27/h1-5,7H,6,8H2,(H,19,22) |
| InChIKey | SFDPRHXKURBXQR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|