C22H26N2S — CID 57393682
3,5-bis(4-tert-butylphenyl)-1,2,4-thiadiazole (PubChem CID 57393682) has the molecular formula C22H26N2S and a molecular weight of 350.53 g/mol. Its IUPAC name is 3,5-bis(4-tert-butylphenyl)-1,2,4-thiadiazole.
| Compound Name | 3,5-bis(4-tert-butylphenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 57393682 |
| Molecular Formula | C22H26N2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3,5-bis(4-tert-butylphenyl)-1,2,4-thiadiazole |
| SMILES | CC(C)(C)c1ccc(-c2nsc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C22H26N2S/c1-21(2,3)17-11-7-15(8-12-17)19-23-20(25-24-19)16-9-13-18(14-10-16)22(4,5)6/h7-14H,1-6H3 |
| InChIKey | XANZXNZYMWKKSF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |