C22H26N4O3 — CID 57393760
methyl 9-[3-[(4-methoxypyrimidin-2-yl)amino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57393760) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is methyl 9-[3-[(4-methoxypyrimidin-2-yl)amino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[3-[(4-methoxypyrimidin-2-yl)amino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57393760 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | methyl 9-[3-[(4-methoxypyrimidin-2-yl)amino]propyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCCNc2nccc(OC)n2)CCCC1 |
| InChI | InChI=1S/C22H26N4O3/c1-28-20-10-12-24-22(25-20)23-11-5-13-26-18-7-4-3-6-16(18)17-14-15(21(27)29-2)8-9-19(17)26/h8-10,12,14H,3-7,11,13H2,1-2H3,(H,23,24,25) |
| InChIKey | VLHBKNGYHQBKQZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|