C20H12ClN5O — CID 57393820
N-(3-chlorophenyl)-7-(1,3,4-oxadiazol-2-yl)benzo[c][2,6]naphthyridin-5-amine (PubChem CID 57393820) has the molecular formula C20H12ClN5O and a molecular weight of 373.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-7-(1,3,4-oxadiazol-2-yl)benzo[c][2,6]naphthyridin-5-amine.
| Compound Name | N-(3-chlorophenyl)-7-(1,3,4-oxadiazol-2-yl)benzo[c][2,6]naphthyridin-5-amine |
|---|---|
| PubChem CID | 57393820 |
| Molecular Formula | C20H12ClN5O |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-(3-chlorophenyl)-7-(1,3,4-oxadiazol-2-yl)benzo[c][2,6]naphthyridin-5-amine |
| SMILES | Clc1cccc(Nc2nc3c(-c4nnco4)cccc3c3cnccc23)c1 |
| InChI | InChI=1S/C20H12ClN5O/c21-12-3-1-4-13(9-12)24-19-15-7-8-22-10-17(15)14-5-2-6-16(18(14)25-19)20-26-23-11-27-20/h1-11H,(H,24,25) |
| InChIKey | RATNMNKEUJOIEP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|