C20H23N3O2S2 — CID 57393877
N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]quinoline-7-sulfonamide (PubChem CID 57393877) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]quinoline-7-sulfonamide.
| Compound Name | N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]quinoline-7-sulfonamide |
|---|---|
| PubChem CID | 57393877 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butyl]quinoline-7-sulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCc2sccc2C1)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C20H23N3O2S2/c24-27(25,18-6-5-16-4-3-9-21-19(16)14-18)22-10-1-2-11-23-12-7-20-17(15-23)8-13-26-20/h3-6,8-9,13-14,22H,1-2,7,10-12,15H2 |
| InChIKey | PXJKEKFBLZNFNX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|