C23H26O3 — CID 57393912
(6aR,8aS,14bR)-6,6,8a-trimethyl-3,4,6a,7,8,14b-hexahydro-2H-chromeno[4,3-a]xanthen-1-one (PubChem CID 57393912) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (6aR,8aS,14bR)-6,6,8a-trimethyl-3,4,6a,7,8,14b-hexahydro-2H-chromeno[4,3-a]xanthen-1-one.
| Compound Name | (6aR,8aS,14bR)-6,6,8a-trimethyl-3,4,6a,7,8,14b-hexahydro-2H-chromeno[4,3-a]xanthen-1-one |
|---|---|
| PubChem CID | 57393912 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (6aR,8aS,14bR)-6,6,8a-trimethyl-3,4,6a,7,8,14b-hexahydro-2H-chromeno[4,3-a]xanthen-1-one |
| SMILES | CC1(C)OC2=C(C(=O)CCC2)[C@H]2C3=Cc4ccccc4O[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C23H26O3/c1-22(2)15-11-12-23(3)16(13-14-7-4-5-9-18(14)26-23)20(15)21-17(24)8-6-10-19(21)25-22/h4-5,7,9,13,15,20H,6,8,10-12H2,1-3H3/t15-,20-,23+/m1/s1 |
| InChIKey | NDUXZCSICWBUGI-OFSQETHSSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |