C17H15F3N4O2 — CID 57393977
5-(6,7-dimethoxycinnolin-4-yl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 57393977) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 5-(6,7-dimethoxycinnolin-4-yl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 5-(6,7-dimethoxycinnolin-4-yl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 57393977 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-(6,7-dimethoxycinnolin-4-yl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | COc1cc2nncc(-c3ccc(NCC(F)(F)F)nc3)c2cc1OC |
| InChI | InChI=1S/C17H15F3N4O2/c1-25-14-5-11-12(8-23-24-13(11)6-15(14)26-2)10-3-4-16(21-7-10)22-9-17(18,19)20/h3-8H,9H2,1-2H3,(H,21,22) |
| InChIKey | UCJKDRQADVKUQZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |