C24H22N6O2 — CID 57393993
5-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one (PubChem CID 57393993) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 5-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 57393993 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 5-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cc(-c3cnc(Nc4ccc(N5CCOCC5)cc4)c4nccn34)ccc21 |
| InChI | InChI=1S/C24H22N6O2/c31-24-20-6-1-16(13-17(20)14-27-24)21-15-26-22(23-25-7-8-30(21)23)28-18-2-4-19(5-3-18)29-9-11-32-12-10-29/h1-8,13,15H,9-12,14H2,(H,26,28)(H,27,31) |
| InChIKey | PMFMZQFBDGJDMA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|