About 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate
2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate (PubChem CID 57394208) has the molecular formula C12H18N2O6
and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate |
| PubChem CID | 57394208 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate |
| SMILES | COCn1cc(CCOC(C)=O)c(=O)n(COC)c1=O |
| InChI | InChI=1S/C12H18N2O6/c1-9(15)20-5-4-10-6-13(7-18-2)12(17)14(8-19-3)11(10)16/h6H,4-5,7-8H2,1-3H3 |
| InChIKey | MKIYYOWZCRVQRT-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate?
The IUPAC name of 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate (CID 57394208) is 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate.
What is the SMILES notation for 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate?
The canonical SMILES for 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate is COCn1cc(CCOC(C)=O)c(=O)n(COC)c1=O.
What is the InChIKey of 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate?
The InChIKey is MKIYYOWZCRVQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O6/c1-9(15)20-5-4-10-6-13(7-18-2)12(17)14(8-19-3)11(10)16/h6H,4-5,7-8H2,1-3H3.
What are the key properties of 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate?
2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate has a molecular weight of 286.28 g/mol, XLogP of -0.68, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-bis(methoxymethyl)-2,4-dioxopyrimidin-5-yl]ethyl acetate is sourced from PubChem (CID 57394208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).