C22H16F3N5O3 — CID 57394289
N-methyl-4-[2-[3-(trifluoromethoxy)anilino]quinazolin-6-yl]oxypyridine-2-carboxamide (PubChem CID 57394289) has the molecular formula C22H16F3N5O3 and a molecular weight of 455.40 g/mol. Its IUPAC name is N-methyl-4-[2-[3-(trifluoromethoxy)anilino]quinazolin-6-yl]oxypyridine-2-carboxamide.
| Compound Name | N-methyl-4-[2-[3-(trifluoromethoxy)anilino]quinazolin-6-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 57394289 |
| Molecular Formula | C22H16F3N5O3 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N-methyl-4-[2-[3-(trifluoromethoxy)anilino]quinazolin-6-yl]oxypyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3nc(Nc4cccc(OC(F)(F)F)c4)ncc3c2)ccn1 |
| InChI | InChI=1S/C22H16F3N5O3/c1-26-20(31)19-11-16(7-8-27-19)32-15-5-6-18-13(9-15)12-28-21(30-18)29-14-3-2-4-17(10-14)33-22(23,24)25/h2-12H,1H3,(H,26,31)(H,28,29,30) |
| InChIKey | ZNTSJCOEQIYFGN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |