C29H37N3O6S — CID 57394298
benzyl N-[(9R,12S,15S)-9-formyl-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]carbamate (PubChem CID 57394298) has the molecular formula C29H37N3O6S and a molecular weight of 555.70 g/mol. Its IUPAC name is benzyl N-[(9R,12S,15S)-9-formyl-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]carbamate.
| Compound Name | benzyl N-[(9R,12S,15S)-9-formyl-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]carbamate |
|---|---|
| PubChem CID | 57394298 |
| Molecular Formula | C29H37N3O6S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | benzyl N-[(9R,12S,15S)-9-formyl-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]carbamate |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](NC(=O)OCc2ccccc2)Cc2ccc(cc2)OCCCCSC[C@@H](C=O)NC1=O |
| InChI | InChI=1S/C29H37N3O6S/c1-20(2)26-28(35)30-23(17-33)19-39-15-7-6-14-37-24-12-10-21(11-13-24)16-25(27(34)32-26)31-29(36)38-18-22-8-4-3-5-9-22/h3-5,8-13,17,20,23,25-26H,6-7,14-16,18-19H2,1-2H3,(H,30,35)(H,31,36)(H,32,34)/t23-,25+,26+/m1/s1 |
| InChIKey | ZRUXRWSDTRMKSB-AFESJLNVSA-N |
| XLogP | 3.25 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|