About 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one
5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 57394326) has the molecular formula C20H20N6O2
and a molecular weight of 376.42 g/mol. Its IUPAC name is 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one |
| PubChem CID | 57394326 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2ncc(-c3ccc(-c4cnc[nH]4)cc3)nc2n1CC1CCOCC1 |
| InChI | InChI=1S/C20H20N6O2/c27-20-25-18-19(26(20)11-13-5-7-28-8-6-13)24-17(10-22-18)15-3-1-14(2-4-15)16-9-21-12-23-16/h1-4,9-10,12-13H,5-8,11H2,(H,21,23)(H,22,25,27) |
| InChIKey | KIRZMVRUIYRWFN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The IUPAC name of 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one (CID 57394326) is 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The canonical SMILES for 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one is O=c1[nH]c2ncc(-c3ccc(-c4cnc[nH]4)cc3)nc2n1CC1CCOCC1.
What is the InChIKey of 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The InChIKey is KIRZMVRUIYRWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N6O2/c27-20-25-18-19(26(20)11-13-5-7-28-8-6-13)24-17(10-22-18)15-3-1-14(2-4-15)16-9-21-12-23-16/h1-4,9-10,12-13H,5-8,11H2,(H,21,23)(H,22,25,27).
What are the key properties of 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one?
5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one has a molecular weight of 376.42 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1H-imidazol-5-yl)phenyl]-3-(oxan-4-ylmethyl)-1H-imidazo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 57394326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).