C22H21N3O2S — CID 57394333
5-(1H-indol-3-ylsulfonyl)-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 57394333) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 5-(1H-indol-3-ylsulfonyl)-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-(1H-indol-3-ylsulfonyl)-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 57394333 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 5-(1H-indol-3-ylsulfonyl)-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | Cn1c2c(c3cc(S(=O)(=O)c4c[nH]c5ccccc45)ccc31)C1CCC(C2)N1 |
| InChI | InChI=1S/C22H21N3O2S/c1-25-19-9-7-14(11-16(19)22-18-8-6-13(24-18)10-20(22)25)28(26,27)21-12-23-17-5-3-2-4-15(17)21/h2-5,7,9,11-13,18,23-24H,6,8,10H2,1H3 |
| InChIKey | BESNZYMZQGHFDT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|