About 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide
2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide (PubChem CID 57394359) has the molecular formula C25H17F3N2O2
and a molecular weight of 434.42 g/mol. Its IUPAC name is 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide |
| PubChem CID | 57394359 |
| Molecular Formula | C25H17F3N2O2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide |
| SMILES | NC(=O)c1ccc2cc(C(=O)Nc3ccc(-c4cccc(C(F)(F)F)c4)cc3)ccc2c1 |
| InChI | InChI=1S/C25H17F3N2O2/c26-25(27,28)21-3-1-2-16(14-21)15-8-10-22(11-9-15)30-24(32)20-7-5-17-12-19(23(29)31)6-4-18(17)13-20/h1-14H,(H2,29,31)(H,30,32) |
| InChIKey | AYZAMPRKDUFKDU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide?
The IUPAC name of 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide (CID 57394359) is 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide.
What is the SMILES notation for 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide?
The canonical SMILES for 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide is NC(=O)c1ccc2cc(C(=O)Nc3ccc(-c4cccc(C(F)(F)F)c4)cc3)ccc2c1.
What is the InChIKey of 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide?
The InChIKey is AYZAMPRKDUFKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17F3N2O2/c26-25(27,28)21-3-1-2-16(14-21)15-8-10-22(11-9-15)30-24(32)20-7-5-17-12-19(23(29)31)6-4-18(17)13-20/h1-14H,(H2,29,31)(H,30,32).
What are the key properties of 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide?
2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide has a molecular weight of 434.42 g/mol, XLogP of 5.88, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[4-[3-(trifluoromethyl)phenyl]phenyl]naphthalene-2,6-dicarboxamide is sourced from PubChem (CID 57394359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).