About [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone
[(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone (PubChem CID 57394453) has the molecular formula C22H25BrN2O
and a molecular weight of 413.36 g/mol. Its IUPAC name is [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone |
| PubChem CID | 57394453 |
| Molecular Formula | C22H25BrN2O |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone |
| SMILES | O=C([C@@H]1CNC[C@H]1c1ccccc1Br)N1CCCCC1c1ccccc1 |
| InChI | InChI=1S/C22H25BrN2O/c23-20-11-5-4-10-17(20)18-14-24-15-19(18)22(26)25-13-7-6-12-21(25)16-8-2-1-3-9-16/h1-5,8-11,18-19,21,24H,6-7,12-15H2/t18-,19+,21?/m0/s1 |
| InChIKey | RZEULNVMLJPCDM-KTVLMBSMSA-N |
| XLogP | 4.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone?
The IUPAC name of [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone (CID 57394453) is [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone.
What is the SMILES notation for [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone?
The canonical SMILES for [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone is O=C([C@@H]1CNC[C@H]1c1ccccc1Br)N1CCCCC1c1ccccc1.
What is the InChIKey of [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone?
The InChIKey is RZEULNVMLJPCDM-KTVLMBSMSA-N. The full InChI is InChI=1S/C22H25BrN2O/c23-20-11-5-4-10-17(20)18-14-24-15-19(18)22(26)25-13-7-6-12-21(25)16-8-2-1-3-9-16/h1-5,8-11,18-19,21,24H,6-7,12-15H2/t18-,19+,21?/m0/s1.
What are the key properties of [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone?
[(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone has a molecular weight of 413.36 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-(2-bromophenyl)pyrrolidin-3-yl]-(2-phenylpiperidin-1-yl)methanone is sourced from PubChem (CID 57394453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).