About sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione
sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione (PubChem CID 57394610) has the molecular formula C10H10N5NaO3
and a molecular weight of 271.21 g/mol. Its IUPAC name is sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione.
Molecular Properties
| Compound Name | sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione |
| PubChem CID | 57394610 |
| Molecular Formula | C10H10N5NaO3 |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione |
| SMILES | C=CCNc1ncnc2c1n([O-])c(=O)c(=O)n2C.[Na+] |
| InChI | InChI=1S/C10H10N5O3.Na/c1-3-4-11-7-6-8(13-5-12-7)14(2)9(16)10(17)15(6)18;/h3,5H,1,4H2,2H3,(H,11,12,13);/q-1;+1 |
| InChIKey | OJQQTPPPOPRLLD-UHFFFAOYSA-N |
| XLogP | -3.56 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione?
The IUPAC name of sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione (CID 57394610) is sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione.
What is the SMILES notation for sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione?
The canonical SMILES for sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione is C=CCNc1ncnc2c1n([O-])c(=O)c(=O)n2C.[Na+].
What is the InChIKey of sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione?
The InChIKey is OJQQTPPPOPRLLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N5O3.Na/c1-3-4-11-7-6-8(13-5-12-7)14(2)9(16)10(17)15(6)18;/h3,5H,1,4H2,2H3,(H,11,12,13);/q-1;+1.
What are the key properties of sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione?
sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione has a molecular weight of 271.21 g/mol, XLogP of -3.56, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 8-methyl-5-oxido-4-(prop-2-enylamino)pteridine-6,7-dione is sourced from PubChem (CID 57394610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).