About (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide
(2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide (PubChem CID 57394731) has the molecular formula C19H26N2O5S
and a molecular weight of 394.49 g/mol. Its IUPAC name is (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide.
Molecular Properties
| Compound Name | (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide |
| PubChem CID | 57394731 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide |
| SMILES | CC(C)CCN([C@@H](C(=O)NO)C(C)O)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H26N2O5S/c1-13(2)10-11-21(18(14(3)22)19(23)20-24)27(25,26)17-9-8-15-6-4-5-7-16(15)12-17/h4-9,12-14,18,22,24H,10-11H2,1-3H3,(H,20,23)/t14?,18-/m1/s1 |
| InChIKey | BCNQQPWDHJUQFQ-XPKAQORNSA-N |
| XLogP | 2.13 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide?
The IUPAC name of (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide (CID 57394731) is (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide.
What is the SMILES notation for (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide?
The canonical SMILES for (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide is CC(C)CCN([C@@H](C(=O)NO)C(C)O)S(=O)(=O)c1ccc2ccccc2c1.
What is the InChIKey of (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide?
The InChIKey is BCNQQPWDHJUQFQ-XPKAQORNSA-N. The full InChI is InChI=1S/C19H26N2O5S/c1-13(2)10-11-21(18(14(3)22)19(23)20-24)27(25,26)17-9-8-15-6-4-5-7-16(15)12-17/h4-9,12-14,18,22,24H,10-11H2,1-3H3,(H,20,23)/t14?,18-/m1/s1.
What are the key properties of (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide?
(2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide has a molecular weight of 394.49 g/mol, XLogP of 2.13, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,3-dihydroxy-2-[3-methylbutyl(naphthalen-2-ylsulfonyl)amino]butanamide is sourced from PubChem (CID 57394731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).