C14H22O3 — CID 57394793
(2R,3aS,9aS)-2-methyl-2-propoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran (PubChem CID 57394793) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2R,3aS,9aS)-2-methyl-2-propoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran.
| Compound Name | (2R,3aS,9aS)-2-methyl-2-propoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
|---|---|
| PubChem CID | 57394793 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2R,3aS,9aS)-2-methyl-2-propoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
| SMILES | CCCO[C@@]1(C)C[C@@H]2OCC3=CCCC[C@]32O1 |
| InChI | InChI=1S/C14H22O3/c1-3-8-16-13(2)9-12-14(17-13)7-5-4-6-11(14)10-15-12/h6,12H,3-5,7-10H2,1-2H3/t12-,13+,14-/m0/s1 |
| InChIKey | XWWSLHBNTBSDJH-MJBXVCDLSA-N |
| XLogP | 2.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|