C18H21N2O8P — CID 57394894
2-[(2R,3S,4R,5R)-5-[2,4-dioxo-5-[(E)-2-phenylethenyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid (PubChem CID 57394894) has the molecular formula C18H21N2O8P and a molecular weight of 424.35 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-[2,4-dioxo-5-[(E)-2-phenylethenyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4R,5R)-5-[2,4-dioxo-5-[(E)-2-phenylethenyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 57394894 |
| Molecular Formula | C18H21N2O8P |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-[2,4-dioxo-5-[(E)-2-phenylethenyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H]2O)cc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H21N2O8P/c21-14-13(8-9-29(25,26)27)28-17(15(14)22)20-10-12(16(23)19-18(20)24)7-6-11-4-2-1-3-5-11/h1-7,10,13-15,17,21-22H,8-9H2,(H,19,23,24)(H2,25,26,27)/b7-6+/t13-,14-,15-,17-/m1/s1 |
| InChIKey | POVBNHRJUINLSB-OFUFTUBTSA-N |
| XLogP | -0.11 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|