C17H21N2O8P — CID 57394895
2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(4-methylphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]ethylphosphonic acid (PubChem CID 57394895) has the molecular formula C17H21N2O8P and a molecular weight of 412.34 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(4-methylphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(4-methylphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 57394895 |
| Molecular Formula | C17H21N2O8P |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(4-methylphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]ethylphosphonic acid |
| SMILES | Cc1ccc(-c2cn([C@@H]3O[C@H](CCP(=O)(O)O)[C@@H](O)[C@H]3O)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H21N2O8P/c1-9-2-4-10(5-3-9)11-8-19(17(23)18-15(11)22)16-14(21)13(20)12(27-16)6-7-28(24,25)26/h2-5,8,12-14,16,20-21H,6-7H2,1H3,(H,18,22,23)(H2,24,25,26)/t12-,13-,14-,16-/m1/s1 |
| InChIKey | XPWLJVZHVNTSLI-IXYNUQLISA-N |
| XLogP | -0.30 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|