C19H23N7O — CID 57394936
11-[6-[2-methoxyethyl(methyl)amino]-2-pyridinyl]-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine (PubChem CID 57394936) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is 11-[6-[2-methoxyethyl(methyl)amino]-2-pyridinyl]-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine.
| Compound Name | 11-[6-[2-methoxyethyl(methyl)amino]-2-pyridinyl]-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
|---|---|
| PubChem CID | 57394936 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 11-[6-[2-methoxyethyl(methyl)amino]-2-pyridinyl]-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
| SMILES | CNc1nc2[nH]c(-c3cccc(N(C)CCOC)n3)cc2c2c1ncn2C |
| InChI | InChI=1S/C19H23N7O/c1-20-19-16-17(26(3)11-21-16)12-10-14(23-18(12)24-19)13-6-5-7-15(22-13)25(2)8-9-27-4/h5-7,10-11H,8-9H2,1-4H3,(H2,20,23,24) |
| InChIKey | WDNLDEPHLHIBLH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |