C15H24ClN3O — CID 57394947
(9R,13R)-4-[(1S)-1-ethoxyethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;hydrochloride (PubChem CID 57394947) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is (9R,13R)-4-[(1S)-1-ethoxyethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;hydrochloride.
| Compound Name | (9R,13R)-4-[(1S)-1-ethoxyethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;hydrochloride |
|---|---|
| PubChem CID | 57394947 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (9R,13R)-4-[(1S)-1-ethoxyethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;hydrochloride |
| SMILES | CCO[C@@H](C)c1ccc2c(n1)N1[C@@H](CNC[C@H]1C)C2.Cl |
| InChI | InChI=1S/C15H23N3O.ClH/c1-4-19-11(3)14-6-5-12-7-13-9-16-8-10(2)18(13)15(12)17-14;/h5-6,10-11,13,16H,4,7-9H2,1-3H3;1H/t10-,11+,13-;/m1./s1 |
| InChIKey | STKGHISQKCYNJI-GYBQEXSMSA-N |
| XLogP | 2.32 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |