About 3-hydroxy-2,2-dimethyltridecan-4-one
3-hydroxy-2,2-dimethyltridecan-4-one (PubChem CID 57394972) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyltridecan-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-2,2-dimethyltridecan-4-one |
| PubChem CID | 57394972 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 3-hydroxy-2,2-dimethyltridecan-4-one |
| SMILES | CCCCCCCCCC(=O)C(O)C(C)(C)C |
| InChI | InChI=1S/C15H30O2/c1-5-6-7-8-9-10-11-12-13(16)14(17)15(2,3)4/h14,17H,5-12H2,1-4H3 |
| InChIKey | XUAJLEJTSNERCO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2,2-dimethyltridecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,2-dimethyltridecan-4-one?
The IUPAC name of 3-hydroxy-2,2-dimethyltridecan-4-one (CID 57394972) is 3-hydroxy-2,2-dimethyltridecan-4-one.
What is the SMILES notation for 3-hydroxy-2,2-dimethyltridecan-4-one?
The canonical SMILES for 3-hydroxy-2,2-dimethyltridecan-4-one is CCCCCCCCCC(=O)C(O)C(C)(C)C.
What is the InChIKey of 3-hydroxy-2,2-dimethyltridecan-4-one?
The InChIKey is XUAJLEJTSNERCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-5-6-7-8-9-10-11-12-13(16)14(17)15(2,3)4/h14,17H,5-12H2,1-4H3.
What are the key properties of 3-hydroxy-2,2-dimethyltridecan-4-one?
3-hydroxy-2,2-dimethyltridecan-4-one has a molecular weight of 242.40 g/mol, XLogP of 4.10, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,2-dimethyltridecan-4-one is sourced from PubChem (CID 57394972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).