About 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one
3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one (PubChem CID 57395000) has the molecular formula C26H30N2O
and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one.
Molecular Properties
| Compound Name | 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one |
| PubChem CID | 57395000 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one |
| SMILES | Cc1ccc(-n2nc3c(c2-c2ccc(C(C)(C)C)cc2)C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C26H30N2O/c1-17-7-13-20(14-8-17)28-24(18-9-11-19(12-10-18)25(2,3)4)23-21(27-28)15-26(5,6)16-22(23)29/h7-14H,15-16H2,1-6H3 |
| InChIKey | GIYCYUNNVJVPGK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one?
The IUPAC name of 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one (CID 57395000) is 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one.
What is the SMILES notation for 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one?
The canonical SMILES for 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one is Cc1ccc(-n2nc3c(c2-c2ccc(C(C)(C)C)cc2)C(=O)CC(C)(C)C3)cc1.
What is the InChIKey of 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one?
The InChIKey is GIYCYUNNVJVPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N2O/c1-17-7-13-20(14-8-17)28-24(18-9-11-19(12-10-18)25(2,3)4)23-21(27-28)15-26(5,6)16-22(23)29/h7-14H,15-16H2,1-6H3.
What are the key properties of 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one?
3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one has a molecular weight of 386.54 g/mol, XLogP of 6.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butylphenyl)-6,6-dimethyl-2-(4-methylphenyl)-5,7-dihydroindazol-4-one is sourced from PubChem (CID 57395000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).