C26H24O5 — CID 57395017
(1R,12S)-6,6-dimethyl-16-phenylmethoxy-5,7,14-trioxapentacyclo[10.8.0.02,10.04,8.015,20]icosa-2,4(8),9,15(20),16,18-hexaen-12-ol (PubChem CID 57395017) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is (1R,12S)-6,6-dimethyl-16-phenylmethoxy-5,7,14-trioxapentacyclo[10.8.0.02,10.04,8.015,20]icosa-2,4(8),9,15(20),16,18-hexaen-12-ol.
| Compound Name | (1R,12S)-6,6-dimethyl-16-phenylmethoxy-5,7,14-trioxapentacyclo[10.8.0.02,10.04,8.015,20]icosa-2,4(8),9,15(20),16,18-hexaen-12-ol |
|---|---|
| PubChem CID | 57395017 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (1R,12S)-6,6-dimethyl-16-phenylmethoxy-5,7,14-trioxapentacyclo[10.8.0.02,10.04,8.015,20]icosa-2,4(8),9,15(20),16,18-hexaen-12-ol |
| SMILES | CC1(C)Oc2cc3c(cc2O1)[C@@H]1c2cccc(OCc4ccccc4)c2OC[C@]1(O)C3 |
| InChI | InChI=1S/C26H24O5/c1-25(2)30-21-11-17-13-26(27)15-29-24-18(23(26)19(17)12-22(21)31-25)9-6-10-20(24)28-14-16-7-4-3-5-8-16/h3-12,23,27H,13-15H2,1-2H3/t23-,26+/m0/s1 |
| InChIKey | JVHGVVAQMJQGKG-JYFHCDHNSA-N |
| XLogP | 4.58 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |