C30H31Cl2N3O5 — CID 57395042
4-[[(4R,5S)-4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]amino]butanoic acid (PubChem CID 57395042) has the molecular formula C30H31Cl2N3O5 and a molecular weight of 584.50 g/mol. Its IUPAC name is 4-[[(4R,5S)-4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[(4R,5S)-4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 57395042 |
| Molecular Formula | C30H31Cl2N3O5 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 4-[[(4R,5S)-4,5-bis(4-chlorophenyl)-2-(4-methoxy-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]amino]butanoic acid |
| SMILES | COc1ccc(C2=N[C@H](c3ccc(Cl)cc3)[C@H](c3ccc(Cl)cc3)N2C(=O)NCCCC(=O)O)c(OC(C)C)c1 |
| InChI | InChI=1S/C30H31Cl2N3O5/c1-18(2)40-25-17-23(39-3)14-15-24(25)29-34-27(19-6-10-21(31)11-7-19)28(20-8-12-22(32)13-9-20)35(29)30(38)33-16-4-5-26(36)37/h6-15,17-18,27-28H,4-5,16H2,1-3H3,(H,33,38)(H,36,37)/t27-,28+/m1/s1 |
| InChIKey | ZEFVVQVBCRYOMX-IZLXSDGUSA-N |
| XLogP | 6.91 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|