C24H32F3N3 — CID 57395050
(4aR,11R,11aS)-11-methyl-2-(2-piperidin-1-ylethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole (PubChem CID 57395050) has the molecular formula C24H32F3N3 and a molecular weight of 419.54 g/mol. Its IUPAC name is (4aR,11R,11aS)-11-methyl-2-(2-piperidin-1-ylethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole.
| Compound Name | (4aR,11R,11aS)-11-methyl-2-(2-piperidin-1-ylethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 57395050 |
| Molecular Formula | C24H32F3N3 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | (4aR,11R,11aS)-11-methyl-2-(2-piperidin-1-ylethyl)-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCN3CCCCC3)C[C@@H]21 |
| InChI | InChI=1S/C24H32F3N3/c1-16-20-15-30(12-11-29-8-3-2-4-9-29)10-7-17(20)13-22-23(16)19-14-18(24(25,26)27)5-6-21(19)28-22/h5-6,14,16-17,20,28H,2-4,7-13,15H2,1H3/t16-,17-,20-/m1/s1 |
| InChIKey | MPXJADGXPKIMSX-MBOZVWFJSA-N |
| XLogP | 5.27 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|