About ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate
ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate (PubChem CID 57395092) has the molecular formula C24H22Cl2N2O3
and a molecular weight of 457.36 g/mol. Its IUPAC name is ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate |
| PubChem CID | 57395092 |
| Molecular Formula | C24H22Cl2N2O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)cc(-c2ccccc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C24H22Cl2N2O3/c1-2-31-24(29)22-18(17-8-9-19(25)20(26)14-17)15-21(16-6-4-3-5-7-16)27-23(22)28-10-12-30-13-11-28/h3-9,14-15H,2,10-13H2,1H3 |
| InChIKey | VYCUNYXMVHPBNR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate?
The IUPAC name of ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate (CID 57395092) is ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate.
What is the SMILES notation for ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate?
The canonical SMILES for ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate is CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)cc(-c2ccccc2)nc1N1CCOCC1.
What is the InChIKey of ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate?
The InChIKey is VYCUNYXMVHPBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl2N2O3/c1-2-31-24(29)22-18(17-8-9-19(25)20(26)14-17)15-21(16-6-4-3-5-7-16)27-23(22)28-10-12-30-13-11-28/h3-9,14-15H,2,10-13H2,1H3.
What are the key properties of ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate?
ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate has a molecular weight of 457.36 g/mol, XLogP of 5.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,4-dichlorophenyl)-2-morpholin-4-yl-6-phenylpyridine-3-carboxylate is sourced from PubChem (CID 57395092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).