C16H20N4O7 — CID 57395103
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methyl]oxane-3,4,5-triol (PubChem CID 57395103) has the molecular formula C16H20N4O7 and a molecular weight of 380.36 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 57395103 |
| Molecular Formula | C16H20N4O7 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methyl]oxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(Cn2cc(C[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)nn2)cc1 |
| InChI | InChI=1S/C16H20N4O7/c21-8-13-15(23)16(24)14(22)12(27-13)5-10-7-19(18-17-10)6-9-1-3-11(4-2-9)20(25)26/h1-4,7,12-16,21-24H,5-6,8H2/t12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | ISRVZUYHRLVGIM-ZVDSWSACSA-N |
| XLogP | -1.38 |
| TPSA | 164.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|