C16H15IN4O3 — CID 57395139
2-(1,3-dimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)-N-(4-iodophenyl)acetamide (PubChem CID 57395139) has the molecular formula C16H15IN4O3 and a molecular weight of 438.23 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)-N-(4-iodophenyl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 57395139 |
| Molecular Formula | C16H15IN4O3 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 2-(1,3-dimethyl-2,4-dioxopyrrolo[3,2-d]pyrimidin-5-yl)-N-(4-iodophenyl)acetamide |
| SMILES | Cn1c(=O)c2c(ccn2CC(=O)Nc2ccc(I)cc2)n(C)c1=O |
| InChI | InChI=1S/C16H15IN4O3/c1-19-12-7-8-21(14(12)15(23)20(2)16(19)24)9-13(22)18-11-5-3-10(17)4-6-11/h3-8H,9H2,1-2H3,(H,18,22) |
| InChIKey | JJIYFRHWAJSTRT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|