C31H43N3O5 — CID 57395238
(3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-[(E)-3-methylbut-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;2-methylpropan-2-amine (PubChem CID 57395238) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-[(E)-3-methylbut-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;2-methylpropan-2-amine.
| Compound Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-[(E)-3-methylbut-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;2-methylpropan-2-amine |
|---|---|
| PubChem CID | 57395238 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-[(E)-3-methylbut-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;2-methylpropan-2-amine |
| SMILES | C/C=C/C=C/C(=O)N1Cc2cc(OCCc3nc(/C=C/C(C)C)oc3C)ccc2C[C@H]1C(=O)O.CC(C)(C)N |
| InChI | InChI=1S/C27H32N2O5.C4H11N/c1-5-6-7-8-26(30)29-17-21-15-22(11-10-20(21)16-24(29)27(31)32)33-14-13-23-19(4)34-25(28-23)12-9-18(2)3;1-4(2,3)5/h5-12,15,18,24H,13-14,16-17H2,1-4H3,(H,31,32);5H2,1-3H3/b6-5+,8-7+,12-9+;/t24-;/m0./s1 |
| InChIKey | AKXRQCXICDJIPB-ZOMMWANESA-N |
| XLogP | 5.49 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|