About 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride (PubChem CID 57395354) has the molecular formula C11H12ClFN4
and a molecular weight of 254.70 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride |
| PubChem CID | 57395354 |
| Molecular Formula | C11H12ClFN4 |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride |
| SMILES | Cl.Fc1cccc2cnn(CC3=NCCN3)c12 |
| InChI | InChI=1S/C11H11FN4.ClH/c12-9-3-1-2-8-6-15-16(11(8)9)7-10-13-4-5-14-10;/h1-3,6H,4-5,7H2,(H,13,14);1H |
| InChIKey | FFPUJQZXOIQVNA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride (CID 57395354) is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride is Cl.Fc1cccc2cnn(CC3=NCCN3)c12.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride?
The InChIKey is FFPUJQZXOIQVNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN4.ClH/c12-9-3-1-2-8-6-15-16(11(8)9)7-10-13-4-5-14-10;/h1-3,6H,4-5,7H2,(H,13,14);1H.
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride?
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride has a molecular weight of 254.70 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-7-fluoroindazole;hydrochloride is sourced from PubChem (CID 57395354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).