C18H17N5O2S — CID 57395408
N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N,2,5-trimethylbenzenesulfonamide (PubChem CID 57395408) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N,2,5-trimethylbenzenesulfonamide.
| Compound Name | N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N,2,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 57395408 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[(E)-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)methylideneamino]-N,2,5-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(C)/N=C/c2cnn3ccc(C#N)cc23)c1 |
| InChI | InChI=1S/C18H17N5O2S/c1-13-4-5-14(2)18(8-13)26(24,25)22(3)20-11-16-12-21-23-7-6-15(10-19)9-17(16)23/h4-9,11-12H,1-3H3/b20-11+ |
| InChIKey | FTMVTSQZJABEAO-RGVLZGJSSA-N |
| XLogP | 2.48 |
| TPSA | 90.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|