C29H31N3O3 — CID 57395428
17-benzyl-4-(2-cyclohexylacetyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-5,6-dione (PubChem CID 57395428) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 17-benzyl-4-(2-cyclohexylacetyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-5,6-dione.
| Compound Name | 17-benzyl-4-(2-cyclohexylacetyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-5,6-dione |
|---|---|
| PubChem CID | 57395428 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 17-benzyl-4-(2-cyclohexylacetyl)-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene-5,6-dione |
| SMILES | O=C(CC1CCCCC1)N1CC2c3c(c4ccccc4n3Cc3ccccc3)CCN2C(=O)C1=O |
| InChI | InChI=1S/C29H31N3O3/c33-26(17-20-9-3-1-4-10-20)32-19-25-27-23(15-16-30(25)28(34)29(32)35)22-13-7-8-14-24(22)31(27)18-21-11-5-2-6-12-21/h2,5-8,11-14,20,25H,1,3-4,9-10,15-19H2 |
| InChIKey | CMDMDVJESQTDPY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|