About benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate
benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate (PubChem CID 57395452) has the molecular formula C16H17NO4
and a molecular weight of 287.31 g/mol. Its IUPAC name is benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate |
| PubChem CID | 57395452 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate |
| SMILES | N#CC=C[C@@H]1CC[C@@H](CC(=O)OCc2ccccc2)OO1 |
| InChI | InChI=1S/C16H17NO4/c17-10-4-7-14-8-9-15(21-20-14)11-16(18)19-12-13-5-2-1-3-6-13/h1-7,14-15H,8-9,11-12H2/t14-,15+/m1/s1 |
| InChIKey | QXRDNSZDBCLCPE-CABCVRRESA-N |
| XLogP | 2.68 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate?
The IUPAC name of benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate (CID 57395452) is benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate.
What is the SMILES notation for benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate?
The canonical SMILES for benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate is N#CC=C[C@@H]1CC[C@@H](CC(=O)OCc2ccccc2)OO1.
What is the InChIKey of benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate?
The InChIKey is QXRDNSZDBCLCPE-CABCVRRESA-N. The full InChI is InChI=1S/C16H17NO4/c17-10-4-7-14-8-9-15(21-20-14)11-16(18)19-12-13-5-2-1-3-6-13/h1-7,14-15H,8-9,11-12H2/t14-,15+/m1/s1.
What are the key properties of benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate?
benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate has a molecular weight of 287.31 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(3S,6S)-6-(2-cyanoethenyl)dioxan-3-yl]acetate is sourced from PubChem (CID 57395452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).