C24H14N2O6S — CID 57395463
5-[(2-benzoyl-3-methyl-5-oxofuro[3,2-g]chromen-6-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 57395463) has the molecular formula C24H14N2O6S and a molecular weight of 458.45 g/mol. Its IUPAC name is 5-[(2-benzoyl-3-methyl-5-oxofuro[3,2-g]chromen-6-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(2-benzoyl-3-methyl-5-oxofuro[3,2-g]chromen-6-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 57395463 |
| Molecular Formula | C24H14N2O6S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 5-[(2-benzoyl-3-methyl-5-oxofuro[3,2-g]chromen-6-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1c(C(=O)c2ccccc2)oc2cc3occ(C=C4C(=O)NC(=S)NC4=O)c(=O)c3cc12 |
| InChI | InChI=1S/C24H14N2O6S/c1-11-14-8-15-17(9-18(14)32-21(11)20(28)12-5-3-2-4-6-12)31-10-13(19(15)27)7-16-22(29)25-24(33)26-23(16)30/h2-10H,1H3,(H2,25,26,29,30,33) |
| InChIKey | FGRGOBRSWHKCKP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|