C23H23N3O2 — CID 57395485
methyl 9-[2-(1H-benzimidazol-2-yl)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57395485) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is methyl 9-[2-(1H-benzimidazol-2-yl)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[2-(1H-benzimidazol-2-yl)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57395485 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | methyl 9-[2-(1H-benzimidazol-2-yl)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCc2nc3ccccc3[nH]2)CCCC1 |
| InChI | InChI=1S/C23H23N3O2/c1-28-23(27)15-10-11-21-17(14-15)16-6-2-5-9-20(16)26(21)13-12-22-24-18-7-3-4-8-19(18)25-22/h3-4,7-8,10-11,14H,2,5-6,9,12-13H2,1H3,(H,24,25) |
| InChIKey | NONKKVBDLOETAF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|