C25H27N3O2 — CID 57395486
methyl 9-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57395486) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 9-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl 9-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57395486 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | methyl 9-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2CCc2nc3cc(C)c(C)cc3[nH]2)CCCC1 |
| InChI | InChI=1S/C25H27N3O2/c1-15-12-20-21(13-16(15)2)27-24(26-20)10-11-28-22-7-5-4-6-18(22)19-14-17(25(29)30-3)8-9-23(19)28/h8-9,12-14H,4-7,10-11H2,1-3H3,(H,26,27) |
| InChIKey | UNEVSGYRSLGITK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|