About 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide
3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide (PubChem CID 57395578) has the molecular formula C15H14N2O4S2
and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide.
Molecular Properties
| Compound Name | 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide |
| PubChem CID | 57395578 |
| Molecular Formula | C15H14N2O4S2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide |
| SMILES | CCc1ccc(C2=NS(=O)(=O)c3cc(S(N)(=O)=O)ccc32)cc1 |
| InChI | InChI=1S/C15H14N2O4S2/c1-2-10-3-5-11(6-4-10)15-13-8-7-12(22(16,18)19)9-14(13)23(20,21)17-15/h3-9H,2H2,1H3,(H2,16,18,19) |
| InChIKey | NSXFNHVBIIRMMP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide?
The IUPAC name of 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide (CID 57395578) is 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide.
What is the SMILES notation for 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide?
The canonical SMILES for 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide is CCc1ccc(C2=NS(=O)(=O)c3cc(S(N)(=O)=O)ccc32)cc1.
What is the InChIKey of 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide?
The InChIKey is NSXFNHVBIIRMMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O4S2/c1-2-10-3-5-11(6-4-10)15-13-8-7-12(22(16,18)19)9-14(13)23(20,21)17-15/h3-9H,2H2,1H3,(H2,16,18,19).
What are the key properties of 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide?
3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide has a molecular weight of 350.42 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethylphenyl)-1,1-dioxo-1,2-benzothiazole-6-sulfonamide is sourced from PubChem (CID 57395578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).