About 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide
5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide (PubChem CID 57395612) has the molecular formula C21H17ClN4O
and a molecular weight of 376.85 g/mol. Its IUPAC name is 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide.
Molecular Properties
| Compound Name | 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide |
| PubChem CID | 57395612 |
| Molecular Formula | C21H17ClN4O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide |
| SMILES | CN(C)C(=O)c1cccc2c1nc(Nc1cccc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C21H17ClN4O/c1-26(2)21(27)17-8-4-7-15-18-12-23-10-9-16(18)20(25-19(15)17)24-14-6-3-5-13(22)11-14/h3-12H,1-2H3,(H,24,25) |
| InChIKey | JKKJNVZWKOURFO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide?
The IUPAC name of 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide (CID 57395612) is 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide.
What is the SMILES notation for 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide?
The canonical SMILES for 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide is CN(C)C(=O)c1cccc2c1nc(Nc1cccc(Cl)c1)c1ccncc12.
What is the InChIKey of 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide?
The InChIKey is JKKJNVZWKOURFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN4O/c1-26(2)21(27)17-8-4-7-15-18-12-23-10-9-16(18)20(25-19(15)17)24-14-6-3-5-13(22)11-14/h3-12H,1-2H3,(H,24,25).
What are the key properties of 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide?
5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide has a molecular weight of 376.85 g/mol, XLogP of 4.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chloroanilino)-N,N-dimethylbenzo[c][2,6]naphthyridine-7-carboxamide is sourced from PubChem (CID 57395612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).