C23H26N2O4 — CID 57395648
(2R,11R,14S)-5,7,10,10,14-pentamethyl-9,15-dioxa-5,7-diazapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),3(8),16,18,20-pentaene-4,6-dione (PubChem CID 57395648) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (2R,11R,14S)-5,7,10,10,14-pentamethyl-9,15-dioxa-5,7-diazapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),3(8),16,18,20-pentaene-4,6-dione.
| Compound Name | (2R,11R,14S)-5,7,10,10,14-pentamethyl-9,15-dioxa-5,7-diazapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),3(8),16,18,20-pentaene-4,6-dione |
|---|---|
| PubChem CID | 57395648 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (2R,11R,14S)-5,7,10,10,14-pentamethyl-9,15-dioxa-5,7-diazapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(22),3(8),16,18,20-pentaene-4,6-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@H]1C3=Cc4ccccc4O[C@@]3(C)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C23H26N2O4/c1-22(2)14-10-11-23(3)15(12-13-8-6-7-9-16(13)28-23)17(14)18-19(26)24(4)21(27)25(5)20(18)29-22/h6-9,12,14,17H,10-11H2,1-5H3/t14-,17-,23+/m1/s1 |
| InChIKey | LOOQYLIFZUHSDC-HBAYXTBCSA-N |
| XLogP | 2.98 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |