C35H52N2O3 — CID 57395699
10-(4-phenylpiperazin-1-yl)decyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 57395699) has the molecular formula C35H52N2O3 and a molecular weight of 548.81 g/mol. Its IUPAC name is 10-(4-phenylpiperazin-1-yl)decyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | 10-(4-phenylpiperazin-1-yl)decyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 57395699 |
| Molecular Formula | C35H52N2O3 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.40 |
| IUPAC Name | 10-(4-phenylpiperazin-1-yl)decyl 2-[(5R,8S,8aS)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCCCCCCCCCCN1CCN(c2ccccc2)CC1)[C@@H]1CC[C@H](C)[C@@H]2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C35H52N2O3/c1-27-17-18-30(25-33-29(3)34(38)26-32(27)33)28(2)35(39)40-24-14-9-7-5-4-6-8-13-19-36-20-22-37(23-21-36)31-15-11-10-12-16-31/h10-12,15-16,27,30,32H,2,4-9,13-14,17-26H2,1,3H3/t27-,30+,32-/m0/s1 |
| InChIKey | PBXBEUSOWKQBQR-KUYURNMDSA-N |
| XLogP | 7.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|