C29H28N2O4 — CID 57395749
4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(9-oxofluoren-1-yl)cyclohexane-1-carboxamide (PubChem CID 57395749) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(9-oxofluoren-1-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(9-oxofluoren-1-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 57395749 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(9-oxofluoren-1-yl)cyclohexane-1-carboxamide |
| SMILES | O=C1c2ccccc2-c2cccc(NC(=O)C3CCC(N4C(=O)[C@@H]5[C@@H]6CC[C@@H](C6)[C@@H]5C4=O)CC3)c21 |
| InChI | InChI=1S/C29H28N2O4/c32-26-21-5-2-1-4-19(21)20-6-3-7-22(25(20)26)30-27(33)15-10-12-18(13-11-15)31-28(34)23-16-8-9-17(14-16)24(23)29(31)35/h1-7,15-18,23-24H,8-14H2,(H,30,33)/t15?,16-,17+,18?,23-,24+ |
| InChIKey | KRWMJLXFLLTBFR-JTXKUEKJSA-N |
| XLogP | 4.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|