About [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol
[4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol (PubChem CID 57395757) has the molecular formula C22H30O
and a molecular weight of 310.48 g/mol. Its IUPAC name is [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol.
Molecular Properties
| Compound Name | [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol |
| PubChem CID | 57395757 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol |
| SMILES | Cc1ccc(-c2cc(C(C)(C)C)cc(C(C)C)c2CO)cc1C |
| InChI | InChI=1S/C22H30O/c1-14(2)19-11-18(22(5,6)7)12-20(21(19)13-23)17-9-8-15(3)16(4)10-17/h8-12,14,23H,13H2,1-7H3 |
| InChIKey | XGJTXYKEBKDNCR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol?
The IUPAC name of [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol (CID 57395757) is [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol.
What is the SMILES notation for [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol?
The canonical SMILES for [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol is Cc1ccc(-c2cc(C(C)(C)C)cc(C(C)C)c2CO)cc1C.
What is the InChIKey of [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol?
The InChIKey is XGJTXYKEBKDNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O/c1-14(2)19-11-18(22(5,6)7)12-20(21(19)13-23)17-9-8-15(3)16(4)10-17/h8-12,14,23H,13H2,1-7H3.
What are the key properties of [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol?
[4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol has a molecular weight of 310.48 g/mol, XLogP of 5.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-tert-butyl-2-(3,4-dimethylphenyl)-6-propan-2-ylphenyl]methanol is sourced from PubChem (CID 57395757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).